About ethane;6-methyl-7-propyl-3-(trifluoromethyl)-1,2-benzoxazole
ethane;6-methyl-7-propyl-3-(trifluoromethyl)-1,2-benzoxazole (PubChem CID 142917151) has the molecular formula C14H18F3NO
and a molecular weight of 273.30 g/mol. Its IUPAC name is ethane;6-methyl-7-propyl-3-(trifluoromethyl)-1,2-benzoxazole.
Molecular Properties
| Compound Name | ethane;6-methyl-7-propyl-3-(trifluoromethyl)-1,2-benzoxazole |
| PubChem CID | 142917151 |
| Molecular Formula | C14H18F3NO |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | ethane;6-methyl-7-propyl-3-(trifluoromethyl)-1,2-benzoxazole |
| SMILES | CC.CCCc1c(C)ccc2c(C(F)(F)F)noc12 |
| InChI | InChI=1S/C12H12F3NO.C2H6/c1-3-4-8-7(2)5-6-9-10(8)17-16-11(9)12(13,14)15;1-2/h5-6H,3-4H2,1-2H3;1-2H3 |
| InChIKey | BVSBNCZBWAHSOU-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;6-methyl-7-propyl-3-(trifluoromethyl)-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-methyl-7-propyl-3-(trifluoromethyl)-1,2-benzoxazole?
The IUPAC name of ethane;6-methyl-7-propyl-3-(trifluoromethyl)-1,2-benzoxazole (CID 142917151) is ethane;6-methyl-7-propyl-3-(trifluoromethyl)-1,2-benzoxazole.
What is the SMILES notation for ethane;6-methyl-7-propyl-3-(trifluoromethyl)-1,2-benzoxazole?
The canonical SMILES for ethane;6-methyl-7-propyl-3-(trifluoromethyl)-1,2-benzoxazole is CC.CCCc1c(C)ccc2c(C(F)(F)F)noc12.
What is the InChIKey of ethane;6-methyl-7-propyl-3-(trifluoromethyl)-1,2-benzoxazole?
The InChIKey is BVSBNCZBWAHSOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F3NO.C2H6/c1-3-4-8-7(2)5-6-9-10(8)17-16-11(9)12(13,14)15;1-2/h5-6H,3-4H2,1-2H3;1-2H3.
What are the key properties of ethane;6-methyl-7-propyl-3-(trifluoromethyl)-1,2-benzoxazole?
ethane;6-methyl-7-propyl-3-(trifluoromethyl)-1,2-benzoxazole has a molecular weight of 273.30 g/mol, XLogP of 5.13, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-methyl-7-propyl-3-(trifluoromethyl)-1,2-benzoxazole is sourced from PubChem (CID 142917151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).