About 1-(3-chloropropyl)-4-[4-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]piperidine
1-(3-chloropropyl)-4-[4-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]piperidine (PubChem CID 142917443) has the molecular formula C16H21ClF3N
and a molecular weight of 319.80 g/mol. Its IUPAC name is 1-(3-chloropropyl)-4-[4-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]piperidine.
Molecular Properties
| Compound Name | 1-(3-chloropropyl)-4-[4-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]piperidine |
| PubChem CID | 142917443 |
| Molecular Formula | C16H21ClF3N |
| Molecular Weight | 319.80 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 1-(3-chloropropyl)-4-[4-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]piperidine |
| SMILES | FC(F)(F)C1=CC=C(C2CCN(CCCCl)CC2)CC=C1 |
| InChI | InChI=1S/C16H21ClF3N/c17-9-2-10-21-11-7-14(8-12-21)13-3-1-4-15(6-5-13)16(18,19)20/h1,4-6,14H,2-3,7-12H2 |
| InChIKey | XTGKMHPGSZSHAE-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.80 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-chloropropyl)-4-[4-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chloropropyl)-4-[4-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]piperidine?
The IUPAC name of 1-(3-chloropropyl)-4-[4-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]piperidine (CID 142917443) is 1-(3-chloropropyl)-4-[4-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]piperidine.
What is the SMILES notation for 1-(3-chloropropyl)-4-[4-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]piperidine?
The canonical SMILES for 1-(3-chloropropyl)-4-[4-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]piperidine is FC(F)(F)C1=CC=C(C2CCN(CCCCl)CC2)CC=C1.
What is the InChIKey of 1-(3-chloropropyl)-4-[4-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]piperidine?
The InChIKey is XTGKMHPGSZSHAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21ClF3N/c17-9-2-10-21-11-7-14(8-12-21)13-3-1-4-15(6-5-13)16(18,19)20/h1,4-6,14H,2-3,7-12H2.
What are the key properties of 1-(3-chloropropyl)-4-[4-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]piperidine?
1-(3-chloropropyl)-4-[4-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]piperidine has a molecular weight of 319.80 g/mol, XLogP of 4.70, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chloropropyl)-4-[4-(trifluoromethyl)cyclohepta-1,3,5-trien-1-yl]piperidine is sourced from PubChem (CID 142917443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).