C25H29ClFN3O — CID 142917515
4-(4-chlorophenyl)-2-[4-[4-(4-fluorophenyl)piperidin-1-yl]butyl]-4-methyl-1H-imidazol-5-one (PubChem CID 142917515) has the molecular formula C25H29ClFN3O and a molecular weight of 441.98 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-[4-[4-(4-fluorophenyl)piperidin-1-yl]butyl]-4-methyl-1H-imidazol-5-one.
| Compound Name | 4-(4-chlorophenyl)-2-[4-[4-(4-fluorophenyl)piperidin-1-yl]butyl]-4-methyl-1H-imidazol-5-one |
|---|---|
| PubChem CID | 142917515 |
| Molecular Formula | C25H29ClFN3O |
| Molecular Weight | 441.98 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | 4-(4-chlorophenyl)-2-[4-[4-(4-fluorophenyl)piperidin-1-yl]butyl]-4-methyl-1H-imidazol-5-one |
| SMILES | CC1(c2ccc(Cl)cc2)N=C(CCCCN2CCC(c3ccc(F)cc3)CC2)NC1=O |
| InChI | InChI=1S/C25H29ClFN3O/c1-25(20-7-9-21(26)10-8-20)24(31)28-23(29-25)4-2-3-15-30-16-13-19(14-17-30)18-5-11-22(27)12-6-18/h5-12,19H,2-4,13-17H2,1H3,(H,28,29,31) |
| InChIKey | YNBKQXGCAXRAFA-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.98 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|