About 3-ethyl-5,5-bis(4-fluorophenyl)-2-thiophen-2-ylimidazol-4-one
3-ethyl-5,5-bis(4-fluorophenyl)-2-thiophen-2-ylimidazol-4-one (PubChem CID 142917718) has the molecular formula C21H16F2N2OS
and a molecular weight of 382.44 g/mol. Its IUPAC name is 3-ethyl-5,5-bis(4-fluorophenyl)-2-thiophen-2-ylimidazol-4-one.
Molecular Properties
| Compound Name | 3-ethyl-5,5-bis(4-fluorophenyl)-2-thiophen-2-ylimidazol-4-one |
| PubChem CID | 142917718 |
| Molecular Formula | C21H16F2N2OS |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 3-ethyl-5,5-bis(4-fluorophenyl)-2-thiophen-2-ylimidazol-4-one |
| SMILES | CCN1C(=O)C(c2ccc(F)cc2)(c2ccc(F)cc2)N=C1c1cccs1 |
| InChI | InChI=1S/C21H16F2N2OS/c1-2-25-19(18-4-3-13-27-18)24-21(20(25)26,14-5-9-16(22)10-6-14)15-7-11-17(23)12-8-15/h3-13H,2H2,1H3 |
| InChIKey | SUJLBUDEKMJCSA-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethyl-5,5-bis(4-fluorophenyl)-2-thiophen-2-ylimidazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5,5-bis(4-fluorophenyl)-2-thiophen-2-ylimidazol-4-one?
The IUPAC name of 3-ethyl-5,5-bis(4-fluorophenyl)-2-thiophen-2-ylimidazol-4-one (CID 142917718) is 3-ethyl-5,5-bis(4-fluorophenyl)-2-thiophen-2-ylimidazol-4-one.
What is the SMILES notation for 3-ethyl-5,5-bis(4-fluorophenyl)-2-thiophen-2-ylimidazol-4-one?
The canonical SMILES for 3-ethyl-5,5-bis(4-fluorophenyl)-2-thiophen-2-ylimidazol-4-one is CCN1C(=O)C(c2ccc(F)cc2)(c2ccc(F)cc2)N=C1c1cccs1.
What is the InChIKey of 3-ethyl-5,5-bis(4-fluorophenyl)-2-thiophen-2-ylimidazol-4-one?
The InChIKey is SUJLBUDEKMJCSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16F2N2OS/c1-2-25-19(18-4-3-13-27-18)24-21(20(25)26,14-5-9-16(22)10-6-14)15-7-11-17(23)12-8-15/h3-13H,2H2,1H3.
What are the key properties of 3-ethyl-5,5-bis(4-fluorophenyl)-2-thiophen-2-ylimidazol-4-one?
3-ethyl-5,5-bis(4-fluorophenyl)-2-thiophen-2-ylimidazol-4-one has a molecular weight of 382.44 g/mol, XLogP of 4.58, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5,5-bis(4-fluorophenyl)-2-thiophen-2-ylimidazol-4-one is sourced from PubChem (CID 142917718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).