About N,N'-dimethylpentanediamide
N,N'-dimethylpentanediamide (PubChem CID 14291790) has the molecular formula C7H14N2O2
and a molecular weight of 158.20 g/mol. Its IUPAC name is N,N'-dimethylpentanediamide.
Molecular Properties
| Compound Name | N,N'-dimethylpentanediamide |
| PubChem CID | 14291790 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | N,N'-dimethylpentanediamide |
| SMILES | CNC(=O)CCCC(=O)NC |
| InChI | InChI=1S/C7H14N2O2/c1-8-6(10)4-3-5-7(11)9-2/h3-5H2,1-2H3,(H,8,10)(H,9,11) |
| InChIKey | XRRGSVDOAOISSO-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N'-dimethylpentanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-dimethylpentanediamide?
The IUPAC name of N,N'-dimethylpentanediamide (CID 14291790) is N,N'-dimethylpentanediamide.
What is the SMILES notation for N,N'-dimethylpentanediamide?
The canonical SMILES for N,N'-dimethylpentanediamide is CNC(=O)CCCC(=O)NC.
What is the InChIKey of N,N'-dimethylpentanediamide?
The InChIKey is XRRGSVDOAOISSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O2/c1-8-6(10)4-3-5-7(11)9-2/h3-5H2,1-2H3,(H,8,10)(H,9,11).
What are the key properties of N,N'-dimethylpentanediamide?
N,N'-dimethylpentanediamide has a molecular weight of 158.20 g/mol, XLogP of -0.35, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-dimethylpentanediamide is sourced from PubChem (CID 14291790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).