About N'-[4-(5-methyl-1,2,4-oxadiazol-3-yl)butyl]ethanimidamide
N'-[4-(5-methyl-1,2,4-oxadiazol-3-yl)butyl]ethanimidamide (PubChem CID 142918024) has the molecular formula C9H16N4O
and a molecular weight of 196.25 g/mol. Its IUPAC name is N'-[4-(5-methyl-1,2,4-oxadiazol-3-yl)butyl]ethanimidamide.
Molecular Properties
| Compound Name | N'-[4-(5-methyl-1,2,4-oxadiazol-3-yl)butyl]ethanimidamide |
| PubChem CID | 142918024 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | N'-[4-(5-methyl-1,2,4-oxadiazol-3-yl)butyl]ethanimidamide |
| SMILES | C/C(N)=N\CCCCc1noc(C)n1 |
| InChI | InChI=1S/C9H16N4O/c1-7(10)11-6-4-3-5-9-12-8(2)14-13-9/h3-6H2,1-2H3,(H2,10,11) |
| InChIKey | XJZGNBDYOJNWBS-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 77.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[4-(5-methyl-1,2,4-oxadiazol-3-yl)butyl]ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[4-(5-methyl-1,2,4-oxadiazol-3-yl)butyl]ethanimidamide?
The IUPAC name of N'-[4-(5-methyl-1,2,4-oxadiazol-3-yl)butyl]ethanimidamide (CID 142918024) is N'-[4-(5-methyl-1,2,4-oxadiazol-3-yl)butyl]ethanimidamide.
What is the SMILES notation for N'-[4-(5-methyl-1,2,4-oxadiazol-3-yl)butyl]ethanimidamide?
The canonical SMILES for N'-[4-(5-methyl-1,2,4-oxadiazol-3-yl)butyl]ethanimidamide is C/C(N)=N\CCCCc1noc(C)n1.
What is the InChIKey of N'-[4-(5-methyl-1,2,4-oxadiazol-3-yl)butyl]ethanimidamide?
The InChIKey is XJZGNBDYOJNWBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4O/c1-7(10)11-6-4-3-5-9-12-8(2)14-13-9/h3-6H2,1-2H3,(H2,10,11).
What are the key properties of N'-[4-(5-methyl-1,2,4-oxadiazol-3-yl)butyl]ethanimidamide?
N'-[4-(5-methyl-1,2,4-oxadiazol-3-yl)butyl]ethanimidamide has a molecular weight of 196.25 g/mol, XLogP of 1.08, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[4-(5-methyl-1,2,4-oxadiazol-3-yl)butyl]ethanimidamide is sourced from PubChem (CID 142918024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).