C10H16 — CID 142918238
3-methylpenta-1,4-dien-2-ylcyclobutane (PubChem CID 142918238) has the molecular formula C10H16 and a molecular weight of 136.24 g/mol. Its IUPAC name is 3-methylpenta-1,4-dien-2-ylcyclobutane.
| Compound Name | 3-methylpenta-1,4-dien-2-ylcyclobutane |
|---|---|
| PubChem CID | 142918238 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | 3-methylpenta-1,4-dien-2-ylcyclobutane |
| SMILES | C=CC(C)C(=C)C1CCC1 |
| InChI | InChI=1S/C10H16/c1-4-8(2)9(3)10-6-5-7-10/h4,8,10H,1,3,5-7H2,2H3 |
| InChIKey | PITPBHMBCVVPRA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|