About 3-methylpenta-1,4-dien-2-ylcyclobutane
3-methylpenta-1,4-dien-2-ylcyclobutane (PubChem CID 142918238) has the molecular formula C10H16
and a molecular weight of 136.24 g/mol. Its IUPAC name is 3-methylpenta-1,4-dien-2-ylcyclobutane.
Molecular Properties
| Compound Name | 3-methylpenta-1,4-dien-2-ylcyclobutane |
| PubChem CID | 142918238 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | 3-methylpenta-1,4-dien-2-ylcyclobutane |
| SMILES | C=CC(C)C(=C)C1CCC1 |
| InChI | InChI=1S/C10H16/c1-4-8(2)9(3)10-6-5-7-10/h4,8,10H,1,3,5-7H2,2H3 |
| InChIKey | PITPBHMBCVVPRA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methylpenta-1,4-dien-2-ylcyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylpenta-1,4-dien-2-ylcyclobutane?
The IUPAC name of 3-methylpenta-1,4-dien-2-ylcyclobutane (CID 142918238) is 3-methylpenta-1,4-dien-2-ylcyclobutane.
What is the SMILES notation for 3-methylpenta-1,4-dien-2-ylcyclobutane?
The canonical SMILES for 3-methylpenta-1,4-dien-2-ylcyclobutane is C=CC(C)C(=C)C1CCC1.
What is the InChIKey of 3-methylpenta-1,4-dien-2-ylcyclobutane?
The InChIKey is PITPBHMBCVVPRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16/c1-4-8(2)9(3)10-6-5-7-10/h4,8,10H,1,3,5-7H2,2H3.
What are the key properties of 3-methylpenta-1,4-dien-2-ylcyclobutane?
3-methylpenta-1,4-dien-2-ylcyclobutane has a molecular weight of 136.24 g/mol, XLogP of 3.16, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylpenta-1,4-dien-2-ylcyclobutane is sourced from PubChem (CID 142918238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).