C28H48N2O — CID 142918915
(E)-N,2-dimethyl-N-[(2E,4E)-2-methyl-4-[(Z)-prop-1-enyl]hepta-2,4,6-trienyl]but-2-enamide;1-heptan-2-ylpyrrolidine (PubChem CID 142918915) has the molecular formula C28H48N2O and a molecular weight of 428.71 g/mol. Its IUPAC name is (E)-N,2-dimethyl-N-[(2E,4E)-2-methyl-4-[(Z)-prop-1-enyl]hepta-2,4,6-trienyl]but-2-enamide;1-heptan-2-ylpyrrolidine.
| Compound Name | (E)-N,2-dimethyl-N-[(2E,4E)-2-methyl-4-[(Z)-prop-1-enyl]hepta-2,4,6-trienyl]but-2-enamide;1-heptan-2-ylpyrrolidine |
|---|---|
| PubChem CID | 142918915 |
| Molecular Formula | C28H48N2O |
| Molecular Weight | 428.71 g/mol |
| Exact Mass | 428.38 |
| IUPAC Name | (E)-N,2-dimethyl-N-[(2E,4E)-2-methyl-4-[(Z)-prop-1-enyl]hepta-2,4,6-trienyl]but-2-enamide;1-heptan-2-ylpyrrolidine |
| SMILES | C=C/C=C(\C=C/C)/C=C(\C)CN(C)C(=O)/C(C)=C/C.CCCCCC(C)N1CCCC1 |
| InChI | InChI=1S/C17H25NO.C11H23N/c1-7-10-16(11-8-2)12-14(4)13-18(6)17(19)15(5)9-3;1-3-4-5-8-11(2)12-9-6-7-10-12/h7-12H,1,13H2,2-6H3;11H,3-10H2,1-2H3/b11-8-,14-12+,15-9+,16-10+; |
| InChIKey | CVLNWQJDRUWKPG-JLCKZKIBSA-N |
| XLogP | 7.10 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.71 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|