C21H24ClNO4S — CID 142919537
(2R)-4-butyl-1-[4-(4-chlorophenyl)phenyl]sulfonylpyrrolidine-2-carboxylic acid (PubChem CID 142919537) has the molecular formula C21H24ClNO4S and a molecular weight of 421.95 g/mol. Its IUPAC name is (2R)-4-butyl-1-[4-(4-chlorophenyl)phenyl]sulfonylpyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-4-butyl-1-[4-(4-chlorophenyl)phenyl]sulfonylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 142919537 |
| Molecular Formula | C21H24ClNO4S |
| Molecular Weight | 421.95 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | (2R)-4-butyl-1-[4-(4-chlorophenyl)phenyl]sulfonylpyrrolidine-2-carboxylic acid |
| SMILES | CCCCC1C[C@H](C(=O)O)N(S(=O)(=O)c2ccc(-c3ccc(Cl)cc3)cc2)C1 |
| InChI | InChI=1S/C21H24ClNO4S/c1-2-3-4-15-13-20(21(24)25)23(14-15)28(26,27)19-11-7-17(8-12-19)16-5-9-18(22)10-6-16/h5-12,15,20H,2-4,13-14H2,1H3,(H,24,25)/t15?,20-/m1/s1 |
| InChIKey | QKEVUAIQDGCWFP-YQYDADCPSA-N |
| XLogP | 4.66 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.95 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |