C24H29NO4S — CID 14291980
(Z)-but-2-enedioic acid;N,N-dimethyl-3-(11-methyl-6,11-dihydrobenzo[c][1]benzothiepin-6-yl)propan-1-amine (PubChem CID 14291980) has the molecular formula C24H29NO4S and a molecular weight of 427.57 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;N,N-dimethyl-3-(11-methyl-6,11-dihydrobenzo[c][1]benzothiepin-6-yl)propan-1-amine.
| Compound Name | (Z)-but-2-enedioic acid;N,N-dimethyl-3-(11-methyl-6,11-dihydrobenzo[c][1]benzothiepin-6-yl)propan-1-amine |
|---|---|
| PubChem CID | 14291980 |
| Molecular Formula | C24H29NO4S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | (Z)-but-2-enedioic acid;N,N-dimethyl-3-(11-methyl-6,11-dihydrobenzo[c][1]benzothiepin-6-yl)propan-1-amine |
| SMILES | CC1c2ccccc2SC(CCCN(C)C)c2ccccc21.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C20H25NS.C4H4O4/c1-15-16-9-4-5-11-18(16)20(13-8-14-21(2)3)22-19-12-7-6-10-17(15)19;5-3(6)1-2-4(7)8/h4-7,9-12,15,20H,8,13-14H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | BADKQZZVPZOAQD-BTJKTKAUSA-N |
| XLogP | 5.04 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|