C27H42N2 — CID 142919820
(4E,6Z)-N-butyl-6-[[(3E,5Z,7Z)-6-ethylnona-3,5,7-trien-2-ylidene]amino]-5-methyl-3-propan-2-ylideneocta-1,4,6-trien-2-amine (PubChem CID 142919820) has the molecular formula C27H42N2 and a molecular weight of 394.65 g/mol. Its IUPAC name is (4E,6Z)-N-butyl-6-[[(3E,5Z,7Z)-6-ethylnona-3,5,7-trien-2-ylidene]amino]-5-methyl-3-propan-2-ylideneocta-1,4,6-trien-2-amine.
| Compound Name | (4E,6Z)-N-butyl-6-[[(3E,5Z,7Z)-6-ethylnona-3,5,7-trien-2-ylidene]amino]-5-methyl-3-propan-2-ylideneocta-1,4,6-trien-2-amine |
|---|---|
| PubChem CID | 142919820 |
| Molecular Formula | C27H42N2 |
| Molecular Weight | 394.65 g/mol |
| Exact Mass | 394.33 |
| IUPAC Name | (4E,6Z)-N-butyl-6-[[(3E,5Z,7Z)-6-ethylnona-3,5,7-trien-2-ylidene]amino]-5-methyl-3-propan-2-ylideneocta-1,4,6-trien-2-amine |
| SMILES | C=C(NCCCC)C(/C=C(C)/C(=C/C)/N=C(C)/C=C/C=C(\C=C/C)CC)=C(C)C |
| InChI | InChI=1S/C27H42N2/c1-10-14-19-28-24(9)26(21(5)6)20-22(7)27(13-4)29-23(8)17-15-18-25(12-3)16-11-2/h11,13,15-18,20,28H,9-10,12,14,19H2,1-8H3/b16-11-,17-15+,22-20+,25-18-,27-13-,29-23+ |
| InChIKey | BAGRPWGCLFMVQC-AMPGWVTKSA-N |
| XLogP | 8.01 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.65 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|