C14H12F2O3S — CID 14291989
2-(benzenesulfonyl)-2,2-difluoro-1-phenylethanol (PubChem CID 14291989) has the molecular formula C14H12F2O3S and a molecular weight of 298.31 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-2,2-difluoro-1-phenylethanol.
| Compound Name | 2-(benzenesulfonyl)-2,2-difluoro-1-phenylethanol |
|---|---|
| PubChem CID | 14291989 |
| Molecular Formula | C14H12F2O3S |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 2-(benzenesulfonyl)-2,2-difluoro-1-phenylethanol |
| SMILES | O=S(=O)(c1ccccc1)C(F)(F)C(O)c1ccccc1 |
| InChI | InChI=1S/C14H12F2O3S/c15-14(16,13(17)11-7-3-1-4-8-11)20(18,19)12-9-5-2-6-10-12/h1-10,13,17H |
| InChIKey | DAKVMUMFLBUNBO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |