About 2-(benzenesulfonyl)-2,2-difluoro-1-(4-methoxyphenyl)ethanol
2-(benzenesulfonyl)-2,2-difluoro-1-(4-methoxyphenyl)ethanol (PubChem CID 14291990) has the molecular formula C15H14F2O4S
and a molecular weight of 328.34 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-2,2-difluoro-1-(4-methoxyphenyl)ethanol.
Molecular Properties
| Compound Name | 2-(benzenesulfonyl)-2,2-difluoro-1-(4-methoxyphenyl)ethanol |
| PubChem CID | 14291990 |
| Molecular Formula | C15H14F2O4S |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 2-(benzenesulfonyl)-2,2-difluoro-1-(4-methoxyphenyl)ethanol |
| SMILES | COc1ccc(C(O)C(F)(F)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C15H14F2O4S/c1-21-12-9-7-11(8-10-12)14(18)15(16,17)22(19,20)13-5-3-2-4-6-13/h2-10,14,18H,1H3 |
| InChIKey | GANHNFMKLBJSNS-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(benzenesulfonyl)-2,2-difluoro-1-(4-methoxyphenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzenesulfonyl)-2,2-difluoro-1-(4-methoxyphenyl)ethanol?
The IUPAC name of 2-(benzenesulfonyl)-2,2-difluoro-1-(4-methoxyphenyl)ethanol (CID 14291990) is 2-(benzenesulfonyl)-2,2-difluoro-1-(4-methoxyphenyl)ethanol.
What is the SMILES notation for 2-(benzenesulfonyl)-2,2-difluoro-1-(4-methoxyphenyl)ethanol?
The canonical SMILES for 2-(benzenesulfonyl)-2,2-difluoro-1-(4-methoxyphenyl)ethanol is COc1ccc(C(O)C(F)(F)S(=O)(=O)c2ccccc2)cc1.
What is the InChIKey of 2-(benzenesulfonyl)-2,2-difluoro-1-(4-methoxyphenyl)ethanol?
The InChIKey is GANHNFMKLBJSNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14F2O4S/c1-21-12-9-7-11(8-10-12)14(18)15(16,17)22(19,20)13-5-3-2-4-6-13/h2-10,14,18H,1H3.
What are the key properties of 2-(benzenesulfonyl)-2,2-difluoro-1-(4-methoxyphenyl)ethanol?
2-(benzenesulfonyl)-2,2-difluoro-1-(4-methoxyphenyl)ethanol has a molecular weight of 328.34 g/mol, XLogP of 2.80, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzenesulfonyl)-2,2-difluoro-1-(4-methoxyphenyl)ethanol is sourced from PubChem (CID 14291990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).