About 2-(benzenesulfonyl)-2,2-difluoro-1-(furan-2-yl)ethanol
2-(benzenesulfonyl)-2,2-difluoro-1-(furan-2-yl)ethanol (PubChem CID 14291992) has the molecular formula C12H10F2O4S
and a molecular weight of 288.27 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-2,2-difluoro-1-(furan-2-yl)ethanol.
Molecular Properties
| Compound Name | 2-(benzenesulfonyl)-2,2-difluoro-1-(furan-2-yl)ethanol |
| PubChem CID | 14291992 |
| Molecular Formula | C12H10F2O4S |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 2-(benzenesulfonyl)-2,2-difluoro-1-(furan-2-yl)ethanol |
| SMILES | O=S(=O)(c1ccccc1)C(F)(F)C(O)c1ccco1 |
| InChI | InChI=1S/C12H10F2O4S/c13-12(14,11(15)10-7-4-8-18-10)19(16,17)9-5-2-1-3-6-9/h1-8,11,15H |
| InChIKey | MIKYBRUVZPPZEG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(benzenesulfonyl)-2,2-difluoro-1-(furan-2-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzenesulfonyl)-2,2-difluoro-1-(furan-2-yl)ethanol?
The IUPAC name of 2-(benzenesulfonyl)-2,2-difluoro-1-(furan-2-yl)ethanol (CID 14291992) is 2-(benzenesulfonyl)-2,2-difluoro-1-(furan-2-yl)ethanol.
What is the SMILES notation for 2-(benzenesulfonyl)-2,2-difluoro-1-(furan-2-yl)ethanol?
The canonical SMILES for 2-(benzenesulfonyl)-2,2-difluoro-1-(furan-2-yl)ethanol is O=S(=O)(c1ccccc1)C(F)(F)C(O)c1ccco1.
What is the InChIKey of 2-(benzenesulfonyl)-2,2-difluoro-1-(furan-2-yl)ethanol?
The InChIKey is MIKYBRUVZPPZEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F2O4S/c13-12(14,11(15)10-7-4-8-18-10)19(16,17)9-5-2-1-3-6-9/h1-8,11,15H.
What are the key properties of 2-(benzenesulfonyl)-2,2-difluoro-1-(furan-2-yl)ethanol?
2-(benzenesulfonyl)-2,2-difluoro-1-(furan-2-yl)ethanol has a molecular weight of 288.27 g/mol, XLogP of 2.38, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzenesulfonyl)-2,2-difluoro-1-(furan-2-yl)ethanol is sourced from PubChem (CID 14291992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).