C7H11NO2 — CID 14292
4,4-dimethylpiperidine-2,6-dione (PubChem CID 14292) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is 4,4-dimethylpiperidine-2,6-dione.
| Compound Name | 4,4-dimethylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 14292 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | 4,4-dimethylpiperidine-2,6-dione |
| SMILES | CC1(C)CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C7H11NO2/c1-7(2)3-5(9)8-6(10)4-7/h3-4H2,1-2H3,(H,8,9,10) |
| InChIKey | YUJCWMGBRDBPDL-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|