C11F23N — CID 14292003
2,2,3,3,4,4,5,5,6,6-decafluoro-1-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)piperidine (PubChem CID 14292003) has the molecular formula C11F23N and a molecular weight of 583.08 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6-decafluoro-1-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)piperidine.
| Compound Name | 2,2,3,3,4,4,5,5,6,6-decafluoro-1-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)piperidine |
|---|---|
| PubChem CID | 14292003 |
| Molecular Formula | C11F23N |
| Molecular Weight | 583.08 g/mol |
| Exact Mass | 582.97 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6-decafluoro-1-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)piperidine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)N1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C11F23N/c12-1(13,4(18,19)8(26,27)28)2(14,15)5(20,21)9(29,30)35-10(31,32)6(22,23)3(16,17)7(24,25)11(35,33)34 |
| InChIKey | GRVJYLQOWJWEFK-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.08 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|