C22H25ClO3S — CID 142920510
6-[(2E,4E)-6-chloro-5-methoxyhepta-2,4,6-trien-2-yl]-5-(4-methylsulfonylphenyl)spiro[2.4]hept-5-ene (PubChem CID 142920510) has the molecular formula C22H25ClO3S and a molecular weight of 404.96 g/mol. Its IUPAC name is 6-[(2E,4E)-6-chloro-5-methoxyhepta-2,4,6-trien-2-yl]-5-(4-methylsulfonylphenyl)spiro[2.4]hept-5-ene.
| Compound Name | 6-[(2E,4E)-6-chloro-5-methoxyhepta-2,4,6-trien-2-yl]-5-(4-methylsulfonylphenyl)spiro[2.4]hept-5-ene |
|---|---|
| PubChem CID | 142920510 |
| Molecular Formula | C22H25ClO3S |
| Molecular Weight | 404.96 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 6-[(2E,4E)-6-chloro-5-methoxyhepta-2,4,6-trien-2-yl]-5-(4-methylsulfonylphenyl)spiro[2.4]hept-5-ene |
| SMILES | C=C(Cl)/C(=C\C=C(/C)C1=C(c2ccc(S(C)(=O)=O)cc2)CC2(CC2)C1)OC |
| InChI | InChI=1S/C22H25ClO3S/c1-15(5-10-21(26-3)16(2)23)19-13-22(11-12-22)14-20(19)17-6-8-18(9-7-17)27(4,24)25/h5-10H,2,11-14H2,1,3-4H3/b15-5+,21-10+ |
| InChIKey | QYOHUQDUBMPLHI-JYFQJBEFSA-N |
| XLogP | 5.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.96 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|