C16H14Cl3N — CID 142920791
(2R)-6,13-dichloro-2-(2-chloroethyl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene (PubChem CID 142920791) has the molecular formula C16H14Cl3N and a molecular weight of 326.65 g/mol. Its IUPAC name is (2R)-6,13-dichloro-2-(2-chloroethyl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene.
| Compound Name | (2R)-6,13-dichloro-2-(2-chloroethyl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
|---|---|
| PubChem CID | 142920791 |
| Molecular Formula | C16H14Cl3N |
| Molecular Weight | 326.65 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | (2R)-6,13-dichloro-2-(2-chloroethyl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
| SMILES | ClCC[C@@H]1c2ccc(Cl)cc2CCc2cc(Cl)cnc21 |
| InChI | InChI=1S/C16H14Cl3N/c17-6-5-15-14-4-3-12(18)7-10(14)1-2-11-8-13(19)9-20-16(11)15/h3-4,7-9,15H,1-2,5-6H2/t15-/m1/s1 |
| InChIKey | LIRAFZXEIJRWCU-OAHLLOKOSA-N |
| XLogP | 5.25 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.65 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|