About [[2,5-difluoro-4-[4-(oxolan-2-ylmethyl)piperazin-1-yl]phenyl]methylamino]thiourea
[[2,5-difluoro-4-[4-(oxolan-2-ylmethyl)piperazin-1-yl]phenyl]methylamino]thiourea (PubChem CID 142921497) has the molecular formula C17H25F2N5OS
and a molecular weight of 385.48 g/mol. Its IUPAC name is [[2,5-difluoro-4-[4-(oxolan-2-ylmethyl)piperazin-1-yl]phenyl]methylamino]thiourea.
Molecular Properties
| Compound Name | [[2,5-difluoro-4-[4-(oxolan-2-ylmethyl)piperazin-1-yl]phenyl]methylamino]thiourea |
| PubChem CID | 142921497 |
| Molecular Formula | C17H25F2N5OS |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | [[2,5-difluoro-4-[4-(oxolan-2-ylmethyl)piperazin-1-yl]phenyl]methylamino]thiourea |
| SMILES | NC(=S)NNCc1cc(F)c(N2CCN(CC3CCCO3)CC2)cc1F |
| InChI | InChI=1S/C17H25F2N5OS/c18-14-9-16(15(19)8-12(14)10-21-22-17(20)26)24-5-3-23(4-6-24)11-13-2-1-7-25-13/h8-9,13,21H,1-7,10-11H2,(H3,20,22,26) |
| InChIKey | HCMIDISHOCZFCY-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [[2,5-difluoro-4-[4-(oxolan-2-ylmethyl)piperazin-1-yl]phenyl]methylamino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[2,5-difluoro-4-[4-(oxolan-2-ylmethyl)piperazin-1-yl]phenyl]methylamino]thiourea?
The IUPAC name of [[2,5-difluoro-4-[4-(oxolan-2-ylmethyl)piperazin-1-yl]phenyl]methylamino]thiourea (CID 142921497) is [[2,5-difluoro-4-[4-(oxolan-2-ylmethyl)piperazin-1-yl]phenyl]methylamino]thiourea.
What is the SMILES notation for [[2,5-difluoro-4-[4-(oxolan-2-ylmethyl)piperazin-1-yl]phenyl]methylamino]thiourea?
The canonical SMILES for [[2,5-difluoro-4-[4-(oxolan-2-ylmethyl)piperazin-1-yl]phenyl]methylamino]thiourea is NC(=S)NNCc1cc(F)c(N2CCN(CC3CCCO3)CC2)cc1F.
What is the InChIKey of [[2,5-difluoro-4-[4-(oxolan-2-ylmethyl)piperazin-1-yl]phenyl]methylamino]thiourea?
The InChIKey is HCMIDISHOCZFCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25F2N5OS/c18-14-9-16(15(19)8-12(14)10-21-22-17(20)26)24-5-3-23(4-6-24)11-13-2-1-7-25-13/h8-9,13,21H,1-7,10-11H2,(H3,20,22,26).
What are the key properties of [[2,5-difluoro-4-[4-(oxolan-2-ylmethyl)piperazin-1-yl]phenyl]methylamino]thiourea?
[[2,5-difluoro-4-[4-(oxolan-2-ylmethyl)piperazin-1-yl]phenyl]methylamino]thiourea has a molecular weight of 385.48 g/mol, XLogP of 1.10, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [[2,5-difluoro-4-[4-(oxolan-2-ylmethyl)piperazin-1-yl]phenyl]methylamino]thiourea is sourced from PubChem (CID 142921497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).