C21H23FN4O3 — CID 142922611
5-fluoro-3-[[(2S)-2-methylhexanoyl]amino]-N-(5-methyl-2-pyridinyl)furo[3,2-b]pyridine-2-carboxamide (PubChem CID 142922611) has the molecular formula C21H23FN4O3 and a molecular weight of 398.44 g/mol. Its IUPAC name is 5-fluoro-3-[[(2S)-2-methylhexanoyl]amino]-N-(5-methyl-2-pyridinyl)furo[3,2-b]pyridine-2-carboxamide.
| Compound Name | 5-fluoro-3-[[(2S)-2-methylhexanoyl]amino]-N-(5-methyl-2-pyridinyl)furo[3,2-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 142922611 |
| Molecular Formula | C21H23FN4O3 |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 5-fluoro-3-[[(2S)-2-methylhexanoyl]amino]-N-(5-methyl-2-pyridinyl)furo[3,2-b]pyridine-2-carboxamide |
| SMILES | CCCC[C@H](C)C(=O)Nc1c(C(=O)Nc2ccc(C)cn2)oc2ccc(F)nc12 |
| InChI | InChI=1S/C21H23FN4O3/c1-4-5-6-13(3)20(27)26-18-17-14(8-9-15(22)24-17)29-19(18)21(28)25-16-10-7-12(2)11-23-16/h7-11,13H,4-6H2,1-3H3,(H,26,27)(H,23,25,28)/t13-/m0/s1 |
| InChIKey | NWSFRDAKLGRIGY-ZDUSSCGKSA-N |
| XLogP | 4.69 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|