C30H33N3O2 — CID 142922671
(E)-1-[4-[[6-[4-(dimethylamino)phenyl]-1H-benzimidazol-2-yl]methyl]phenyl]-8-hydroxyoct-1-en-3-one (PubChem CID 142922671) has the molecular formula C30H33N3O2 and a molecular weight of 467.61 g/mol. Its IUPAC name is (E)-1-[4-[[6-[4-(dimethylamino)phenyl]-1H-benzimidazol-2-yl]methyl]phenyl]-8-hydroxyoct-1-en-3-one.
| Compound Name | (E)-1-[4-[[6-[4-(dimethylamino)phenyl]-1H-benzimidazol-2-yl]methyl]phenyl]-8-hydroxyoct-1-en-3-one |
|---|---|
| PubChem CID | 142922671 |
| Molecular Formula | C30H33N3O2 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | (E)-1-[4-[[6-[4-(dimethylamino)phenyl]-1H-benzimidazol-2-yl]methyl]phenyl]-8-hydroxyoct-1-en-3-one |
| SMILES | CN(C)c1ccc(-c2ccc3nc(Cc4ccc(/C=C/C(=O)CCCCCO)cc4)[nH]c3c2)cc1 |
| InChI | InChI=1S/C30H33N3O2/c1-33(2)26-15-12-24(13-16-26)25-14-18-28-29(21-25)32-30(31-28)20-23-9-7-22(8-10-23)11-17-27(35)6-4-3-5-19-34/h7-18,21,34H,3-6,19-20H2,1-2H3,(H,31,32)/b17-11+ |
| InChIKey | TXMGJSYHXGZAKS-GZTJUZNOSA-N |
| XLogP | 6.02 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|