C21H29N3O3S2 — CID 142922855
[N'-[(1R,2S)-2-cyclohexyl-1-(4-propan-2-ylsulfonylphenyl)cyclopropanecarbonyl]carbamimidoyl] methanimidothioate (PubChem CID 142922855) has the molecular formula C21H29N3O3S2 and a molecular weight of 435.62 g/mol. Its IUPAC name is [N'-[(1R,2S)-2-cyclohexyl-1-(4-propan-2-ylsulfonylphenyl)cyclopropanecarbonyl]carbamimidoyl] methanimidothioate.
| Compound Name | [N'-[(1R,2S)-2-cyclohexyl-1-(4-propan-2-ylsulfonylphenyl)cyclopropanecarbonyl]carbamimidoyl] methanimidothioate |
|---|---|
| PubChem CID | 142922855 |
| Molecular Formula | C21H29N3O3S2 |
| Molecular Weight | 435.62 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | [N'-[(1R,2S)-2-cyclohexyl-1-(4-propan-2-ylsulfonylphenyl)cyclopropanecarbonyl]carbamimidoyl] methanimidothioate |
| SMILES | [H]/N=C/S/C(N)=N/C(=O)[C@]1(c2ccc(S(=O)(=O)C(C)C)cc2)C[C@H]1C1CCCCC1 |
| InChI | InChI=1S/C21H29N3O3S2/c1-14(2)29(26,27)17-10-8-16(9-11-17)21(19(25)24-20(23)28-13-22)12-18(21)15-6-4-3-5-7-15/h8-11,13-15,18,22H,3-7,12H2,1-2H3,(H2,23,24,25)/b22-13+/t18-,21-/m0/s1 |
| InChIKey | YTQZCVXVTDLJHR-ZGYKXIANSA-N |
| XLogP | 3.89 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.62 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|