About 1-(2,3-dihydropyrazin-5-yl)-3-ethylurea;molecular hydrogen
1-(2,3-dihydropyrazin-5-yl)-3-ethylurea;molecular hydrogen (PubChem CID 142923244) has the molecular formula C7H16N4O
and a molecular weight of 172.23 g/mol. Its IUPAC name is 1-(2,3-dihydropyrazin-5-yl)-3-ethylurea;molecular hydrogen.
Molecular Properties
| Compound Name | 1-(2,3-dihydropyrazin-5-yl)-3-ethylurea;molecular hydrogen |
| PubChem CID | 142923244 |
| Molecular Formula | C7H16N4O |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | 1-(2,3-dihydropyrazin-5-yl)-3-ethylurea;molecular hydrogen |
| SMILES | CCNC(=O)NC1=NCCN=C1.[H][H].[H][H] |
| InChI | InChI=1S/C7H12N4O.2H2/c1-2-9-7(12)11-6-5-8-3-4-10-6;;/h5H,2-4H2,1H3,(H2,9,10,11,12);2*1H |
| InChIKey | KLSZOOLWJHRMFS-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 65.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2,3-dihydropyrazin-5-yl)-3-ethylurea;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dihydropyrazin-5-yl)-3-ethylurea;molecular hydrogen?
The IUPAC name of 1-(2,3-dihydropyrazin-5-yl)-3-ethylurea;molecular hydrogen (CID 142923244) is 1-(2,3-dihydropyrazin-5-yl)-3-ethylurea;molecular hydrogen.
What is the SMILES notation for 1-(2,3-dihydropyrazin-5-yl)-3-ethylurea;molecular hydrogen?
The canonical SMILES for 1-(2,3-dihydropyrazin-5-yl)-3-ethylurea;molecular hydrogen is CCNC(=O)NC1=NCCN=C1.[H][H].[H][H].
What is the InChIKey of 1-(2,3-dihydropyrazin-5-yl)-3-ethylurea;molecular hydrogen?
The InChIKey is KLSZOOLWJHRMFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4O.2H2/c1-2-9-7(12)11-6-5-8-3-4-10-6;;/h5H,2-4H2,1H3,(H2,9,10,11,12);2*1H.
What are the key properties of 1-(2,3-dihydropyrazin-5-yl)-3-ethylurea;molecular hydrogen?
1-(2,3-dihydropyrazin-5-yl)-3-ethylurea;molecular hydrogen has a molecular weight of 172.23 g/mol, XLogP of 0.28, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dihydropyrazin-5-yl)-3-ethylurea;molecular hydrogen is sourced from PubChem (CID 142923244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).