C27H40N6O — CID 142923601
N-[3-(diethylamino)propyl]-2-(2-methyl-1H-imidazo[4,5-b]pyridin-7-yl)-1H-indole-6-carboxamide;ethane (PubChem CID 142923601) has the molecular formula C27H40N6O and a molecular weight of 464.66 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-2-(2-methyl-1H-imidazo[4,5-b]pyridin-7-yl)-1H-indole-6-carboxamide;ethane.
| Compound Name | N-[3-(diethylamino)propyl]-2-(2-methyl-1H-imidazo[4,5-b]pyridin-7-yl)-1H-indole-6-carboxamide;ethane |
|---|---|
| PubChem CID | 142923601 |
| Molecular Formula | C27H40N6O |
| Molecular Weight | 464.66 g/mol |
| Exact Mass | 464.33 |
| IUPAC Name | N-[3-(diethylamino)propyl]-2-(2-methyl-1H-imidazo[4,5-b]pyridin-7-yl)-1H-indole-6-carboxamide;ethane |
| SMILES | CC.CC.CCN(CC)CCCNC(=O)c1ccc2cc(-c3ccnc4nc(C)[nH]c34)[nH]c2c1 |
| InChI | InChI=1S/C23H28N6O.2C2H6/c1-4-29(5-2)12-6-10-25-23(30)17-8-7-16-13-20(28-19(16)14-17)18-9-11-24-22-21(18)26-15(3)27-22;2*1-2/h7-9,11,13-14,28H,4-6,10,12H2,1-3H3,(H,25,30)(H,24,26,27);2*1-2H3 |
| InChIKey | KDKATRUCCZVYCF-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.66 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|