About benzene;N-methyl-1-(2-methyl-1,3-thiazol-4-yl)cyclobutan-1-amine
benzene;N-methyl-1-(2-methyl-1,3-thiazol-4-yl)cyclobutan-1-amine (PubChem CID 142924405) has the molecular formula C15H20N2S
and a molecular weight of 260.41 g/mol. Its IUPAC name is benzene;N-methyl-1-(2-methyl-1,3-thiazol-4-yl)cyclobutan-1-amine.
Molecular Properties
| Compound Name | benzene;N-methyl-1-(2-methyl-1,3-thiazol-4-yl)cyclobutan-1-amine |
| PubChem CID | 142924405 |
| Molecular Formula | C15H20N2S |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | benzene;N-methyl-1-(2-methyl-1,3-thiazol-4-yl)cyclobutan-1-amine |
| SMILES | CNC1(c2csc(C)n2)CCC1.c1ccccc1 |
| InChI | InChI=1S/C9H14N2S.C6H6/c1-7-11-8(6-12-7)9(10-2)4-3-5-9;1-2-4-6-5-3-1/h6,10H,3-5H2,1-2H3;1-6H |
| InChIKey | ILVPQYSNBSBMJJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzene;N-methyl-1-(2-methyl-1,3-thiazol-4-yl)cyclobutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;N-methyl-1-(2-methyl-1,3-thiazol-4-yl)cyclobutan-1-amine?
The IUPAC name of benzene;N-methyl-1-(2-methyl-1,3-thiazol-4-yl)cyclobutan-1-amine (CID 142924405) is benzene;N-methyl-1-(2-methyl-1,3-thiazol-4-yl)cyclobutan-1-amine.
What is the SMILES notation for benzene;N-methyl-1-(2-methyl-1,3-thiazol-4-yl)cyclobutan-1-amine?
The canonical SMILES for benzene;N-methyl-1-(2-methyl-1,3-thiazol-4-yl)cyclobutan-1-amine is CNC1(c2csc(C)n2)CCC1.c1ccccc1.
What is the InChIKey of benzene;N-methyl-1-(2-methyl-1,3-thiazol-4-yl)cyclobutan-1-amine?
The InChIKey is ILVPQYSNBSBMJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2S.C6H6/c1-7-11-8(6-12-7)9(10-2)4-3-5-9;1-2-4-6-5-3-1/h6,10H,3-5H2,1-2H3;1-6H.
What are the key properties of benzene;N-methyl-1-(2-methyl-1,3-thiazol-4-yl)cyclobutan-1-amine?
benzene;N-methyl-1-(2-methyl-1,3-thiazol-4-yl)cyclobutan-1-amine has a molecular weight of 260.41 g/mol, XLogP of 3.74, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;N-methyl-1-(2-methyl-1,3-thiazol-4-yl)cyclobutan-1-amine is sourced from PubChem (CID 142924405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).