About (Z)-but-2-ene;ethane;(E)-N-methylpent-3-en-2-amine
(Z)-but-2-ene;ethane;(E)-N-methylpent-3-en-2-amine (PubChem CID 142924416) has the molecular formula C12H27N
and a molecular weight of 185.35 g/mol. Its IUPAC name is (Z)-but-2-ene;ethane;(E)-N-methylpent-3-en-2-amine.
Molecular Properties
| Compound Name | (Z)-but-2-ene;ethane;(E)-N-methylpent-3-en-2-amine |
| PubChem CID | 142924416 |
| Molecular Formula | C12H27N |
| Molecular Weight | 185.35 g/mol |
| Exact Mass | 185.21 |
| IUPAC Name | (Z)-but-2-ene;ethane;(E)-N-methylpent-3-en-2-amine |
| SMILES | C/C=C/C(C)NC.C/C=C\C.CC |
| InChI | InChI=1S/C6H13N.C4H8.C2H6/c1-4-5-6(2)7-3;1-3-4-2;1-2/h4-7H,1-3H3;3-4H,1-2H3;1-2H3/b5-4+;4-3-; |
| InChIKey | PSPROGHZGHIPBR-NWBJJHEDSA-N |
| XLogP | 3.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.35 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-ene;ethane;(E)-N-methylpent-3-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-ene;ethane;(E)-N-methylpent-3-en-2-amine?
The IUPAC name of (Z)-but-2-ene;ethane;(E)-N-methylpent-3-en-2-amine (CID 142924416) is (Z)-but-2-ene;ethane;(E)-N-methylpent-3-en-2-amine.
What is the SMILES notation for (Z)-but-2-ene;ethane;(E)-N-methylpent-3-en-2-amine?
The canonical SMILES for (Z)-but-2-ene;ethane;(E)-N-methylpent-3-en-2-amine is C/C=C/C(C)NC.C/C=C\C.CC.
What is the InChIKey of (Z)-but-2-ene;ethane;(E)-N-methylpent-3-en-2-amine?
The InChIKey is PSPROGHZGHIPBR-NWBJJHEDSA-N. The full InChI is InChI=1S/C6H13N.C4H8.C2H6/c1-4-5-6(2)7-3;1-3-4-2;1-2/h4-7H,1-3H3;3-4H,1-2H3;1-2H3/b5-4+;4-3-;.
What are the key properties of (Z)-but-2-ene;ethane;(E)-N-methylpent-3-en-2-amine?
(Z)-but-2-ene;ethane;(E)-N-methylpent-3-en-2-amine has a molecular weight of 185.35 g/mol, XLogP of 3.78, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-ene;ethane;(E)-N-methylpent-3-en-2-amine is sourced from PubChem (CID 142924416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).