C34H34ClN3O5 — CID 142924901
2-[3-(3-chlorophenyl)-4-[2-[4-(hydroxymethoxy)phenyl]acetyl]-5-methyl-2-oxo-1,4-diazepan-1-yl]-3-naphthalen-1-ylpropanamide (PubChem CID 142924901) has the molecular formula C34H34ClN3O5 and a molecular weight of 600.12 g/mol. Its IUPAC name is 2-[3-(3-chlorophenyl)-4-[2-[4-(hydroxymethoxy)phenyl]acetyl]-5-methyl-2-oxo-1,4-diazepan-1-yl]-3-naphthalen-1-ylpropanamide.
| Compound Name | 2-[3-(3-chlorophenyl)-4-[2-[4-(hydroxymethoxy)phenyl]acetyl]-5-methyl-2-oxo-1,4-diazepan-1-yl]-3-naphthalen-1-ylpropanamide |
|---|---|
| PubChem CID | 142924901 |
| Molecular Formula | C34H34ClN3O5 |
| Molecular Weight | 600.12 g/mol |
| Exact Mass | 599.22 |
| IUPAC Name | 2-[3-(3-chlorophenyl)-4-[2-[4-(hydroxymethoxy)phenyl]acetyl]-5-methyl-2-oxo-1,4-diazepan-1-yl]-3-naphthalen-1-ylpropanamide |
| SMILES | CC1CCN(C(Cc2cccc3ccccc23)C(N)=O)C(=O)C(c2cccc(Cl)c2)N1C(=O)Cc1ccc(OCO)cc1 |
| InChI | InChI=1S/C34H34ClN3O5/c1-22-16-17-37(30(33(36)41)20-25-8-4-7-24-6-2-3-11-29(24)25)34(42)32(26-9-5-10-27(35)19-26)38(22)31(40)18-23-12-14-28(15-13-23)43-21-39/h2-15,19,22,30,32,39H,16-18,20-21H2,1H3,(H2,36,41) |
| InChIKey | ZGGZHBUYABONSE-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 113.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.12 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|