C30H30F4N2 — CID 142925200
4-[1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)ethenyl]-N-[1-[2-fluoro-4-(trifluoromethyl)phenyl]ethenyl]naphthalen-1-amine (PubChem CID 142925200) has the molecular formula C30H30F4N2 and a molecular weight of 494.58 g/mol. Its IUPAC name is 4-[1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)ethenyl]-N-[1-[2-fluoro-4-(trifluoromethyl)phenyl]ethenyl]naphthalen-1-amine.
| Compound Name | 4-[1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)ethenyl]-N-[1-[2-fluoro-4-(trifluoromethyl)phenyl]ethenyl]naphthalen-1-amine |
|---|---|
| PubChem CID | 142925200 |
| Molecular Formula | C30H30F4N2 |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | 4-[1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)ethenyl]-N-[1-[2-fluoro-4-(trifluoromethyl)phenyl]ethenyl]naphthalen-1-amine |
| SMILES | C=C(Nc1ccc(C(=C)N2CCCC3CCCCC32)c2ccccc12)c1ccc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C30H30F4N2/c1-19(23-14-13-22(18-27(23)31)30(32,33)34)35-28-16-15-24(25-10-4-5-11-26(25)28)20(2)36-17-7-9-21-8-3-6-12-29(21)36/h4-5,10-11,13-16,18,21,29,35H,1-3,6-9,12,17H2 |
| InChIKey | RMWSTRODTFNHDU-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |