C24H26ClFN2O2 — CID 142925208
N-[4-(8a-methyl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-2-carbonyl)-3-chlorophenyl]-2-fluorobenzamide (PubChem CID 142925208) has the molecular formula C24H26ClFN2O2 and a molecular weight of 428.94 g/mol. Its IUPAC name is N-[4-(8a-methyl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-2-carbonyl)-3-chlorophenyl]-2-fluorobenzamide.
| Compound Name | N-[4-(8a-methyl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-2-carbonyl)-3-chlorophenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 142925208 |
| Molecular Formula | C24H26ClFN2O2 |
| Molecular Weight | 428.94 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | N-[4-(8a-methyl-1,3,4,4a,5,6,7,8-octahydroisoquinoline-2-carbonyl)-3-chlorophenyl]-2-fluorobenzamide |
| SMILES | CC12CCCCC1CCN(C(=O)c1ccc(NC(=O)c3ccccc3F)cc1Cl)C2 |
| InChI | InChI=1S/C24H26ClFN2O2/c1-24-12-5-4-6-16(24)11-13-28(15-24)23(30)18-10-9-17(14-20(18)25)27-22(29)19-7-2-3-8-21(19)26/h2-3,7-10,14,16H,4-6,11-13,15H2,1H3,(H,27,29) |
| InChIKey | MKZGPZLJZPMEGA-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.94 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |