C32H45N3O4 — CID 142925372
N-[4-(8a-amino-1,3,4,4a,5,6,7,8-octahydroisoquinoline-2-carbonyl)-3-propoxyphenyl]-4-hexoxybenzamide (PubChem CID 142925372) has the molecular formula C32H45N3O4 and a molecular weight of 535.73 g/mol. Its IUPAC name is N-[4-(8a-amino-1,3,4,4a,5,6,7,8-octahydroisoquinoline-2-carbonyl)-3-propoxyphenyl]-4-hexoxybenzamide.
| Compound Name | N-[4-(8a-amino-1,3,4,4a,5,6,7,8-octahydroisoquinoline-2-carbonyl)-3-propoxyphenyl]-4-hexoxybenzamide |
|---|---|
| PubChem CID | 142925372 |
| Molecular Formula | C32H45N3O4 |
| Molecular Weight | 535.73 g/mol |
| Exact Mass | 535.34 |
| IUPAC Name | N-[4-(8a-amino-1,3,4,4a,5,6,7,8-octahydroisoquinoline-2-carbonyl)-3-propoxyphenyl]-4-hexoxybenzamide |
| SMILES | CCCCCCOc1ccc(C(=O)Nc2ccc(C(=O)N3CCC4CCCCC4(N)C3)c(OCCC)c2)cc1 |
| InChI | InChI=1S/C32H45N3O4/c1-3-5-6-9-21-38-27-14-11-24(12-15-27)30(36)34-26-13-16-28(29(22-26)39-20-4-2)31(37)35-19-17-25-10-7-8-18-32(25,33)23-35/h11-16,22,25H,3-10,17-21,23,33H2,1-2H3,(H,34,36) |
| InChIKey | AUQCTIGOTKHNKR-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.73 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|