C8H14N2O2 — CID 142925625
1,5-dimethyl-2H-pyrazine-3,6-dione;ethane (PubChem CID 142925625) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is 1,5-dimethyl-2H-pyrazine-3,6-dione;ethane.
| Compound Name | 1,5-dimethyl-2H-pyrazine-3,6-dione;ethane |
|---|---|
| PubChem CID | 142925625 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 1,5-dimethyl-2H-pyrazine-3,6-dione;ethane |
| SMILES | CC.CC1=NC(=O)CN(C)C1=O |
| InChI | InChI=1S/C6H8N2O2.C2H6/c1-4-6(10)8(2)3-5(9)7-4;1-2/h3H2,1-2H3;1-2H3 |
| InChIKey | FBRMUASQQAFUHC-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |