C16H14O4 — CID 14292597
9,10-dimethylanthracene-2,3,6,7-tetrol (PubChem CID 14292597) has the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. Its IUPAC name is 9,10-dimethylanthracene-2,3,6,7-tetrol.
| Compound Name | 9,10-dimethylanthracene-2,3,6,7-tetrol |
|---|---|
| PubChem CID | 14292597 |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 9,10-dimethylanthracene-2,3,6,7-tetrol |
| SMILES | Cc1c2cc(O)c(O)cc2c(C)c2cc(O)c(O)cc12 |
| InChI | InChI=1S/C16H14O4/c1-7-9-3-13(17)15(19)5-11(9)8(2)12-6-16(20)14(18)4-10(7)12/h3-6,17-20H,1-2H3 |
| InChIKey | LSRBZTZFDKGLOB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|