C27H36F2O3 — CID 142926439
ethyl (2Z,4E,6E)-7-(8-ethyl-3-hydroxy-5,5,8-trimethyl-6,7-dihydronaphthalen-2-yl)-2,6-difluoro-3-methylnona-2,4,6-trienoate (PubChem CID 142926439) has the molecular formula C27H36F2O3 and a molecular weight of 446.58 g/mol. Its IUPAC name is ethyl (2Z,4E,6E)-7-(8-ethyl-3-hydroxy-5,5,8-trimethyl-6,7-dihydronaphthalen-2-yl)-2,6-difluoro-3-methylnona-2,4,6-trienoate.
| Compound Name | ethyl (2Z,4E,6E)-7-(8-ethyl-3-hydroxy-5,5,8-trimethyl-6,7-dihydronaphthalen-2-yl)-2,6-difluoro-3-methylnona-2,4,6-trienoate |
|---|---|
| PubChem CID | 142926439 |
| Molecular Formula | C27H36F2O3 |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | ethyl (2Z,4E,6E)-7-(8-ethyl-3-hydroxy-5,5,8-trimethyl-6,7-dihydronaphthalen-2-yl)-2,6-difluoro-3-methylnona-2,4,6-trienoate |
| SMILES | CCOC(=O)/C(F)=C(C)/C=C/C(F)=C(/CC)c1cc2c(cc1O)C(C)(C)CCC2(C)CC |
| InChI | InChI=1S/C27H36F2O3/c1-8-18(22(28)12-11-17(4)24(29)25(31)32-10-3)19-15-21-20(16-23(19)30)26(5,6)13-14-27(21,7)9-2/h11-12,15-16,30H,8-10,13-14H2,1-7H3/b12-11+,22-18+,24-17- |
| InChIKey | AESOZGPACXANHG-DIBFJXPCSA-N |
| XLogP | 7.58 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|