About 2-fluoro-6-hydroxy-8-iodo-3-(3-methylpiperazin-1-yl)-6H-indolo[2,1-b]quinazolin-12-one
2-fluoro-6-hydroxy-8-iodo-3-(3-methylpiperazin-1-yl)-6H-indolo[2,1-b]quinazolin-12-one (PubChem CID 142926815) has the molecular formula C20H18FIN4O2
and a molecular weight of 492.29 g/mol. Its IUPAC name is 2-fluoro-6-hydroxy-8-iodo-3-(3-methylpiperazin-1-yl)-6H-indolo[2,1-b]quinazolin-12-one.
Molecular Properties
| Compound Name | 2-fluoro-6-hydroxy-8-iodo-3-(3-methylpiperazin-1-yl)-6H-indolo[2,1-b]quinazolin-12-one |
| PubChem CID | 142926815 |
| Molecular Formula | C20H18FIN4O2 |
| Molecular Weight | 492.29 g/mol |
| Exact Mass | 492.05 |
| IUPAC Name | 2-fluoro-6-hydroxy-8-iodo-3-(3-methylpiperazin-1-yl)-6H-indolo[2,1-b]quinazolin-12-one |
| SMILES | CC1CN(c2cc3nc4n(c(=O)c3cc2F)-c2ccc(I)cc2C4O)CCN1 |
| InChI | InChI=1S/C20H18FIN4O2/c1-10-9-25(5-4-23-10)17-8-15-12(7-14(17)21)20(28)26-16-3-2-11(22)6-13(16)18(27)19(26)24-15/h2-3,6-8,10,18,23,27H,4-5,9H2,1H3 |
| InChIKey | YNXHBTVBWQFWHF-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 492.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-6-hydroxy-8-iodo-3-(3-methylpiperazin-1-yl)-6H-indolo[2,1-b]quinazolin-12-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-6-hydroxy-8-iodo-3-(3-methylpiperazin-1-yl)-6H-indolo[2,1-b]quinazolin-12-one?
The IUPAC name of 2-fluoro-6-hydroxy-8-iodo-3-(3-methylpiperazin-1-yl)-6H-indolo[2,1-b]quinazolin-12-one (CID 142926815) is 2-fluoro-6-hydroxy-8-iodo-3-(3-methylpiperazin-1-yl)-6H-indolo[2,1-b]quinazolin-12-one.
What is the SMILES notation for 2-fluoro-6-hydroxy-8-iodo-3-(3-methylpiperazin-1-yl)-6H-indolo[2,1-b]quinazolin-12-one?
The canonical SMILES for 2-fluoro-6-hydroxy-8-iodo-3-(3-methylpiperazin-1-yl)-6H-indolo[2,1-b]quinazolin-12-one is CC1CN(c2cc3nc4n(c(=O)c3cc2F)-c2ccc(I)cc2C4O)CCN1.
What is the InChIKey of 2-fluoro-6-hydroxy-8-iodo-3-(3-methylpiperazin-1-yl)-6H-indolo[2,1-b]quinazolin-12-one?
The InChIKey is YNXHBTVBWQFWHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18FIN4O2/c1-10-9-25(5-4-23-10)17-8-15-12(7-14(17)21)20(28)26-16-3-2-11(22)6-13(16)18(27)19(26)24-15/h2-3,6-8,10,18,23,27H,4-5,9H2,1H3.
What are the key properties of 2-fluoro-6-hydroxy-8-iodo-3-(3-methylpiperazin-1-yl)-6H-indolo[2,1-b]quinazolin-12-one?
2-fluoro-6-hydroxy-8-iodo-3-(3-methylpiperazin-1-yl)-6H-indolo[2,1-b]quinazolin-12-one has a molecular weight of 492.29 g/mol, XLogP of 2.32, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-6-hydroxy-8-iodo-3-(3-methylpiperazin-1-yl)-6H-indolo[2,1-b]quinazolin-12-one is sourced from PubChem (CID 142926815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).