C8H18FN3O2S — CID 142926906
4-[fluoro(methyl)amino]-N,N-dimethylpiperidine-1-sulfonamide (PubChem CID 142926906) has the molecular formula C8H18FN3O2S and a molecular weight of 239.32 g/mol. Its IUPAC name is 4-[fluoro(methyl)amino]-N,N-dimethylpiperidine-1-sulfonamide.
| Compound Name | 4-[fluoro(methyl)amino]-N,N-dimethylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 142926906 |
| Molecular Formula | C8H18FN3O2S |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 4-[fluoro(methyl)amino]-N,N-dimethylpiperidine-1-sulfonamide |
| SMILES | CN(F)C1CCN(S(=O)(=O)N(C)C)CC1 |
| InChI | InChI=1S/C8H18FN3O2S/c1-10(2)15(13,14)12-6-4-8(5-7-12)11(3)9/h8H,4-7H2,1-3H3 |
| InChIKey | LKKWICCHONXXJM-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|