C10H18N2 — CID 142927286
propane;(1Z)-1-[(Z)-prop-2-enylideneamino]buta-1,3-dien-1-amine (PubChem CID 142927286) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is propane;(1Z)-1-[(Z)-prop-2-enylideneamino]buta-1,3-dien-1-amine.
| Compound Name | propane;(1Z)-1-[(Z)-prop-2-enylideneamino]buta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 142927286 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | propane;(1Z)-1-[(Z)-prop-2-enylideneamino]buta-1,3-dien-1-amine |
| SMILES | C=C/C=N\C(N)=C/C=C.CCC |
| InChI | InChI=1S/C7H10N2.C3H8/c1-3-5-7(8)9-6-4-2;1-3-2/h3-6H,1-2,8H2;3H2,1-2H3/b7-5-,9-6-; |
| InChIKey | AOQJUQHYCRRLTA-ORYMYBSFSA-N |
| XLogP | 2.65 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|