C23H33N7O4S — CID 142927532
2-acetamido-4-[2-[4-(diaminomethylideneamino)cyclohexa-1,3-dien-1-yl]ethyl]-N-(4-morpholin-4-yl-4-oxobutyl)-1,3-thiazole-5-carboxamide (PubChem CID 142927532) has the molecular formula C23H33N7O4S and a molecular weight of 503.63 g/mol. Its IUPAC name is 2-acetamido-4-[2-[4-(diaminomethylideneamino)cyclohexa-1,3-dien-1-yl]ethyl]-N-(4-morpholin-4-yl-4-oxobutyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-acetamido-4-[2-[4-(diaminomethylideneamino)cyclohexa-1,3-dien-1-yl]ethyl]-N-(4-morpholin-4-yl-4-oxobutyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 142927532 |
| Molecular Formula | C23H33N7O4S |
| Molecular Weight | 503.63 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | 2-acetamido-4-[2-[4-(diaminomethylideneamino)cyclohexa-1,3-dien-1-yl]ethyl]-N-(4-morpholin-4-yl-4-oxobutyl)-1,3-thiazole-5-carboxamide |
| SMILES | CC(=O)Nc1nc(CCC2=CC=C(N=C(N)N)CC2)c(C(=O)NCCCC(=O)N2CCOCC2)s1 |
| InChI | InChI=1S/C23H33N7O4S/c1-15(31)27-23-29-18(9-6-16-4-7-17(8-5-16)28-22(24)25)20(35-23)21(33)26-10-2-3-19(32)30-11-13-34-14-12-30/h4,7H,2-3,5-6,8-14H2,1H3,(H,26,33)(H4,24,25,28)(H,27,29,31) |
| InChIKey | JEKFUSZPWBEGDU-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 165.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.63 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|