C10H11NO2S — CID 142927872
6-methyl-7-(oxomethylidene)-2,3,4,4a-tetrahydrothiopyrano[3,2-c]pyridin-5-one (PubChem CID 142927872) has the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. Its IUPAC name is 6-methyl-7-(oxomethylidene)-2,3,4,4a-tetrahydrothiopyrano[3,2-c]pyridin-5-one.
| Compound Name | 6-methyl-7-(oxomethylidene)-2,3,4,4a-tetrahydrothiopyrano[3,2-c]pyridin-5-one |
|---|---|
| PubChem CID | 142927872 |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 6-methyl-7-(oxomethylidene)-2,3,4,4a-tetrahydrothiopyrano[3,2-c]pyridin-5-one |
| SMILES | CN1C(=O)C2CCCSC2=CC1=C=O |
| InChI | InChI=1S/C10H11NO2S/c1-11-7(6-12)5-9-8(10(11)13)3-2-4-14-9/h5,8H,2-4H2,1H3 |
| InChIKey | NQQKZWDPMMEICK-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|