C17H21BrN2O3 — CID 142928274
methyl 4-[(2E,4Z)-6-bromohepta-2,4,6-trien-3-yl]-3-morpholin-4-yl-1H-pyrrole-2-carboxylate (PubChem CID 142928274) has the molecular formula C17H21BrN2O3 and a molecular weight of 381.27 g/mol. Its IUPAC name is methyl 4-[(2E,4Z)-6-bromohepta-2,4,6-trien-3-yl]-3-morpholin-4-yl-1H-pyrrole-2-carboxylate.
| Compound Name | methyl 4-[(2E,4Z)-6-bromohepta-2,4,6-trien-3-yl]-3-morpholin-4-yl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 142928274 |
| Molecular Formula | C17H21BrN2O3 |
| Molecular Weight | 381.27 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | methyl 4-[(2E,4Z)-6-bromohepta-2,4,6-trien-3-yl]-3-morpholin-4-yl-1H-pyrrole-2-carboxylate |
| SMILES | C=C(Br)/C=C\C(=C/C)c1c[nH]c(C(=O)OC)c1N1CCOCC1 |
| InChI | InChI=1S/C17H21BrN2O3/c1-4-13(6-5-12(2)18)14-11-19-15(17(21)22-3)16(14)20-7-9-23-10-8-20/h4-6,11,19H,2,7-10H2,1,3H3/b6-5-,13-4+ |
| InChIKey | YBSIRNBFUZYGNI-BDNXDWBHSA-N |
| XLogP | 3.51 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.27 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|