C13H13Cl2NO2 — CID 142928635
3-(2,4-dichloro-6-methylphenyl)-5,5-dimethylpyrrolidine-2,4-dione (PubChem CID 142928635) has the molecular formula C13H13Cl2NO2 and a molecular weight of 286.16 g/mol. Its IUPAC name is 3-(2,4-dichloro-6-methylphenyl)-5,5-dimethylpyrrolidine-2,4-dione.
| Compound Name | 3-(2,4-dichloro-6-methylphenyl)-5,5-dimethylpyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 142928635 |
| Molecular Formula | C13H13Cl2NO2 |
| Molecular Weight | 286.16 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | 3-(2,4-dichloro-6-methylphenyl)-5,5-dimethylpyrrolidine-2,4-dione |
| SMILES | Cc1cc(Cl)cc(Cl)c1C1C(=O)NC(C)(C)C1=O |
| InChI | InChI=1S/C13H13Cl2NO2/c1-6-4-7(14)5-8(15)9(6)10-11(17)13(2,3)16-12(10)18/h4-5,10H,1-3H3,(H,16,18) |
| InChIKey | FZJAKNBHKRMXMI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.16 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|