C14H18N2 — CID 142928653
4,12-dimethyl-4,8-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),10,13-tetraene (PubChem CID 142928653) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 4,12-dimethyl-4,8-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),10,13-tetraene.
| Compound Name | 4,12-dimethyl-4,8-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),10,13-tetraene |
|---|---|
| PubChem CID | 142928653 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 4,12-dimethyl-4,8-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),10,13-tetraene |
| SMILES | CC1C=Cc2[nH]c3c(c2C=C1)CN(C)CC3 |
| InChI | InChI=1S/C14H18N2/c1-10-3-5-11-12-9-16(2)8-7-14(12)15-13(11)6-4-10/h3-6,10,15H,7-9H2,1-2H3 |
| InChIKey | GELFVGVEPCBHNM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |