C12H20FNO — CID 142929017
(5E)-6-fluoro-2-[(E)-2-methoxyprop-1-enyl]-N,N-dimethylhexa-3,5-dien-1-amine (PubChem CID 142929017) has the molecular formula C12H20FNO and a molecular weight of 213.30 g/mol. Its IUPAC name is (5E)-6-fluoro-2-[(E)-2-methoxyprop-1-enyl]-N,N-dimethylhexa-3,5-dien-1-amine.
| Compound Name | (5E)-6-fluoro-2-[(E)-2-methoxyprop-1-enyl]-N,N-dimethylhexa-3,5-dien-1-amine |
|---|---|
| PubChem CID | 142929017 |
| Molecular Formula | C12H20FNO |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | (5E)-6-fluoro-2-[(E)-2-methoxyprop-1-enyl]-N,N-dimethylhexa-3,5-dien-1-amine |
| SMILES | CO/C(C)=C/C(C=C/C=C/F)CN(C)C |
| InChI | InChI=1S/C12H20FNO/c1-11(15-4)9-12(10-14(2)3)7-5-6-8-13/h5-9,12H,10H2,1-4H3/b7-5?,8-6+,11-9+ |
| InChIKey | CPTNTQGKPAQJGF-GKDQZFSASA-N |
| XLogP | 2.75 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|