C21H23F3N4O3S — CID 142929110
N-[(2E,4E)-4-[[5,5-dimethyl-2,4-dioxo-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidin-1-yl]methyl]-6-methyliminohexa-2,4-dien-2-yl]formamide (PubChem CID 142929110) has the molecular formula C21H23F3N4O3S and a molecular weight of 468.50 g/mol. Its IUPAC name is N-[(2E,4E)-4-[[5,5-dimethyl-2,4-dioxo-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidin-1-yl]methyl]-6-methyliminohexa-2,4-dien-2-yl]formamide.
| Compound Name | N-[(2E,4E)-4-[[5,5-dimethyl-2,4-dioxo-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidin-1-yl]methyl]-6-methyliminohexa-2,4-dien-2-yl]formamide |
|---|---|
| PubChem CID | 142929110 |
| Molecular Formula | C21H23F3N4O3S |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | N-[(2E,4E)-4-[[5,5-dimethyl-2,4-dioxo-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidin-1-yl]methyl]-6-methyliminohexa-2,4-dien-2-yl]formamide |
| SMILES | C/N=C/C=C(\C=C(/C)NC=O)CN1C(=O)N(c2ccc(SC(F)(F)F)cc2)C(=O)C1(C)C |
| InChI | InChI=1S/C21H23F3N4O3S/c1-14(26-13-29)11-15(9-10-25-4)12-27-19(31)28(18(30)20(27,2)3)16-5-7-17(8-6-16)32-21(22,23)24/h5-11,13H,12H2,1-4H3,(H,26,29)/b14-11+,15-9+,25-10+ |
| InChIKey | NDBXHCUUZQRYHS-PZTNXALSSA-N |
| XLogP | 4.12 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|