C29H38F3N5O2S — CID 142929122
(Z)-N-[4-[[5,5-dimethyl-2,4-dioxo-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidin-1-yl]methyl]-2-pyridinyl]-N',4-dimethylhept-5-enimidamide;ethane (PubChem CID 142929122) has the molecular formula C29H38F3N5O2S and a molecular weight of 577.72 g/mol. Its IUPAC name is (Z)-N-[4-[[5,5-dimethyl-2,4-dioxo-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidin-1-yl]methyl]-2-pyridinyl]-N',4-dimethylhept-5-enimidamide;ethane.
| Compound Name | (Z)-N-[4-[[5,5-dimethyl-2,4-dioxo-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidin-1-yl]methyl]-2-pyridinyl]-N',4-dimethylhept-5-enimidamide;ethane |
|---|---|
| PubChem CID | 142929122 |
| Molecular Formula | C29H38F3N5O2S |
| Molecular Weight | 577.72 g/mol |
| Exact Mass | 577.27 |
| IUPAC Name | (Z)-N-[4-[[5,5-dimethyl-2,4-dioxo-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidin-1-yl]methyl]-2-pyridinyl]-N',4-dimethylhept-5-enimidamide;ethane |
| SMILES | C/C=C\C(C)CC/C(=N\C)Nc1cc(CN2C(=O)N(c3ccc(SC(F)(F)F)cc3)C(=O)C2(C)C)ccn1.CC |
| InChI | InChI=1S/C27H32F3N5O2S.C2H6/c1-6-7-18(2)8-13-22(31-5)33-23-16-19(14-15-32-23)17-34-25(37)35(24(36)26(34,3)4)20-9-11-21(12-10-20)38-27(28,29)30;1-2/h6-7,9-12,14-16,18H,8,13,17H2,1-5H3,(H,31,32,33);1-2H3/b7-6-; |
| InChIKey | VRWQAEZNEWCING-NAFXZHHSSA-N |
| XLogP | 7.90 |
| TPSA | 77.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.72 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|