C28H40N6O5 — CID 142929433
acetaldehyde;tert-butyl 4-[12-[5-(methylaminomethyl)-2-oxo-1,3-oxazolidin-3-yl]-3,4-diazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11,13-pentaen-5-yl]piperazine-1-carboxylate (PubChem CID 142929433) has the molecular formula C28H40N6O5 and a molecular weight of 540.67 g/mol. Its IUPAC name is acetaldehyde;tert-butyl 4-[12-[5-(methylaminomethyl)-2-oxo-1,3-oxazolidin-3-yl]-3,4-diazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11,13-pentaen-5-yl]piperazine-1-carboxylate.
| Compound Name | acetaldehyde;tert-butyl 4-[12-[5-(methylaminomethyl)-2-oxo-1,3-oxazolidin-3-yl]-3,4-diazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11,13-pentaen-5-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 142929433 |
| Molecular Formula | C28H40N6O5 |
| Molecular Weight | 540.67 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | acetaldehyde;tert-butyl 4-[12-[5-(methylaminomethyl)-2-oxo-1,3-oxazolidin-3-yl]-3,4-diazatricyclo[8.4.0.02,6]tetradeca-1(10),2(6),4,11,13-pentaen-5-yl]piperazine-1-carboxylate |
| SMILES | CC=O.CNCC1CN(c2ccc3c(c2)CCCc2c(N4CCN(C(=O)OC(C)(C)C)CC4)n[nH]c2-3)C(=O)O1 |
| InChI | InChI=1S/C26H36N6O4.C2H4O/c1-26(2,3)36-24(33)31-12-10-30(11-13-31)23-21-7-5-6-17-14-18(8-9-20(17)22(21)28-29-23)32-16-19(15-27-4)35-25(32)34;1-2-3/h8-9,14,19,27H,5-7,10-13,15-16H2,1-4H3,(H,28,29);2H,1H3 |
| InChIKey | XFEUMXKQXHUSQL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 120.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.67 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|