About ethane;ethyl (5Z,6E)-6-ethylidene-5-prop-2-enylidenepyridine-3-carboxylate
ethane;ethyl (5Z,6E)-6-ethylidene-5-prop-2-enylidenepyridine-3-carboxylate (PubChem CID 142929711) has the molecular formula C15H21NO2
and a molecular weight of 247.34 g/mol. Its IUPAC name is ethane;ethyl (5Z,6E)-6-ethylidene-5-prop-2-enylidenepyridine-3-carboxylate.
Molecular Properties
| Compound Name | ethane;ethyl (5Z,6E)-6-ethylidene-5-prop-2-enylidenepyridine-3-carboxylate |
| PubChem CID | 142929711 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | ethane;ethyl (5Z,6E)-6-ethylidene-5-prop-2-enylidenepyridine-3-carboxylate |
| SMILES | C=C/C=c1/cc(C(=O)OCC)cn/c1=C/C.CC |
| InChI | InChI=1S/C13H15NO2.C2H6/c1-4-7-10-8-11(13(15)16-6-3)9-14-12(10)5-2;1-2/h4-5,7-9H,1,6H2,2-3H3;1-2H3/b10-7-,12-5+; |
| InChIKey | JHCJXTOEYNJNBE-MMPKGUEUSA-N |
| XLogP | 2.05 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;ethyl (5Z,6E)-6-ethylidene-5-prop-2-enylidenepyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethyl (5Z,6E)-6-ethylidene-5-prop-2-enylidenepyridine-3-carboxylate?
The IUPAC name of ethane;ethyl (5Z,6E)-6-ethylidene-5-prop-2-enylidenepyridine-3-carboxylate (CID 142929711) is ethane;ethyl (5Z,6E)-6-ethylidene-5-prop-2-enylidenepyridine-3-carboxylate.
What is the SMILES notation for ethane;ethyl (5Z,6E)-6-ethylidene-5-prop-2-enylidenepyridine-3-carboxylate?
The canonical SMILES for ethane;ethyl (5Z,6E)-6-ethylidene-5-prop-2-enylidenepyridine-3-carboxylate is C=C/C=c1/cc(C(=O)OCC)cn/c1=C/C.CC.
What is the InChIKey of ethane;ethyl (5Z,6E)-6-ethylidene-5-prop-2-enylidenepyridine-3-carboxylate?
The InChIKey is JHCJXTOEYNJNBE-MMPKGUEUSA-N. The full InChI is InChI=1S/C13H15NO2.C2H6/c1-4-7-10-8-11(13(15)16-6-3)9-14-12(10)5-2;1-2/h4-5,7-9H,1,6H2,2-3H3;1-2H3/b10-7-,12-5+;.
What are the key properties of ethane;ethyl (5Z,6E)-6-ethylidene-5-prop-2-enylidenepyridine-3-carboxylate?
ethane;ethyl (5Z,6E)-6-ethylidene-5-prop-2-enylidenepyridine-3-carboxylate has a molecular weight of 247.34 g/mol, XLogP of 2.05, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethyl (5Z,6E)-6-ethylidene-5-prop-2-enylidenepyridine-3-carboxylate is sourced from PubChem (CID 142929711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).