C16H19FN2O — CID 142929726
N-[(2E,4Z)-4-(aminomethyl)hepta-2,4,6-trien-2-yl]-4-fluorocyclohepta-1,3,5-triene-1-carboxamide (PubChem CID 142929726) has the molecular formula C16H19FN2O and a molecular weight of 274.34 g/mol. Its IUPAC name is N-[(2E,4Z)-4-(aminomethyl)hepta-2,4,6-trien-2-yl]-4-fluorocyclohepta-1,3,5-triene-1-carboxamide.
| Compound Name | N-[(2E,4Z)-4-(aminomethyl)hepta-2,4,6-trien-2-yl]-4-fluorocyclohepta-1,3,5-triene-1-carboxamide |
|---|---|
| PubChem CID | 142929726 |
| Molecular Formula | C16H19FN2O |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | N-[(2E,4Z)-4-(aminomethyl)hepta-2,4,6-trien-2-yl]-4-fluorocyclohepta-1,3,5-triene-1-carboxamide |
| SMILES | C=C/C=C(/C=C(\C)NC(=O)C1=CC=C(F)C=CC1)CN |
| InChI | InChI=1S/C16H19FN2O/c1-3-5-13(11-18)10-12(2)19-16(20)14-6-4-7-15(17)9-8-14/h3-5,7-10H,1,6,11,18H2,2H3,(H,19,20)/b12-10+,13-5- |
| InChIKey | MSQWQWPIDJQPCO-QXMMSASQSA-N |
| XLogP | 2.82 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|