C25H33F5N4O2 — CID 142930491
3-[[1-[(3R)-3-amino-4-(2,5-difluorophenyl)butanoyl]-5-methyl-2,3,4,7-tetrahydroazepin-6-yl]imino]-N-tert-butyl-4,4,4-trifluorobutanamide (PubChem CID 142930491) has the molecular formula C25H33F5N4O2 and a molecular weight of 516.56 g/mol. Its IUPAC name is 3-[[1-[(3R)-3-amino-4-(2,5-difluorophenyl)butanoyl]-5-methyl-2,3,4,7-tetrahydroazepin-6-yl]imino]-N-tert-butyl-4,4,4-trifluorobutanamide.
| Compound Name | 3-[[1-[(3R)-3-amino-4-(2,5-difluorophenyl)butanoyl]-5-methyl-2,3,4,7-tetrahydroazepin-6-yl]imino]-N-tert-butyl-4,4,4-trifluorobutanamide |
|---|---|
| PubChem CID | 142930491 |
| Molecular Formula | C25H33F5N4O2 |
| Molecular Weight | 516.56 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | 3-[[1-[(3R)-3-amino-4-(2,5-difluorophenyl)butanoyl]-5-methyl-2,3,4,7-tetrahydroazepin-6-yl]imino]-N-tert-butyl-4,4,4-trifluorobutanamide |
| SMILES | CC1=C(/N=C(\CC(=O)NC(C)(C)C)C(F)(F)F)CN(C(=O)C[C@H](N)Cc2cc(F)ccc2F)CCC1 |
| InChI | InChI=1S/C25H33F5N4O2/c1-15-6-5-9-34(23(36)12-18(31)11-16-10-17(26)7-8-19(16)27)14-20(15)32-21(25(28,29)30)13-22(35)33-24(2,3)4/h7-8,10,18H,5-6,9,11-14,31H2,1-4H3,(H,33,35)/b32-21+/t18-/m1/s1 |
| InChIKey | SSYFIUKXYXUXFN-JKEOFBESSA-N |
| XLogP | 4.43 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.56 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|