C9H10N2S — CID 142930870
3-[(1E,3Z)-hexa-1,3,5-trienyl]-5-methyl-1,2,4-thiadiazole (PubChem CID 142930870) has the molecular formula C9H10N2S and a molecular weight of 178.26 g/mol. Its IUPAC name is 3-[(1E,3Z)-hexa-1,3,5-trienyl]-5-methyl-1,2,4-thiadiazole.
| Compound Name | 3-[(1E,3Z)-hexa-1,3,5-trienyl]-5-methyl-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 142930870 |
| Molecular Formula | C9H10N2S |
| Molecular Weight | 178.26 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 3-[(1E,3Z)-hexa-1,3,5-trienyl]-5-methyl-1,2,4-thiadiazole |
| SMILES | C=C/C=C\C=C\c1nsc(C)n1 |
| InChI | InChI=1S/C9H10N2S/c1-3-4-5-6-7-9-10-8(2)12-11-9/h3-7H,1H2,2H3/b5-4-,7-6+ |
| InChIKey | AMGMNPNNFRGHPQ-SCFJQAPRSA-N |
| XLogP | 2.60 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|