C23H26N6OS — CID 1429309
1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-[1-(pyridin-3-ylmethylsulfanyl)-[1,2,4]triazolo[3,4-b]benzimidazol-4-yl]ethanone (PubChem CID 1429309) has the molecular formula C23H26N6OS and a molecular weight of 434.57 g/mol. Its IUPAC name is 1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-[1-(pyridin-3-ylmethylsulfanyl)-[1,2,4]triazolo[3,4-b]benzimidazol-4-yl]ethanone.
| Compound Name | 1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-[1-(pyridin-3-ylmethylsulfanyl)-[1,2,4]triazolo[3,4-b]benzimidazol-4-yl]ethanone |
|---|---|
| PubChem CID | 1429309 |
| Molecular Formula | C23H26N6OS |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-[1-(pyridin-3-ylmethylsulfanyl)-[1,2,4]triazolo[3,4-b]benzimidazol-4-yl]ethanone |
| SMILES | C[C@H]1CCC[C@H](C)N1C(=O)Cn1c2ccccc2n2c(SCc3cccnc3)nnc12 |
| InChI | InChI=1S/C23H26N6OS/c1-16-7-5-8-17(2)28(16)21(30)14-27-19-10-3-4-11-20(19)29-22(27)25-26-23(29)31-15-18-9-6-12-24-13-18/h3-4,6,9-13,16-17H,5,7-8,14-15H2,1-2H3/t16-,17-/m0/s1 |
| InChIKey | VJRWIOMMWRBMDP-IRXDYDNUSA-N |
| XLogP | 4.16 |
| TPSA | 68.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |